Matlystatin D
It is produced by the strain of Actinomadura atramentaria. It's a Type V collagenase inhibitor. It can inhibit type IV collagenase and type I collagenase with ID50 (μmol/L) of 3.64 and 28, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02310 |
| Pricing | Inquire |
| Cas | 140638-25-1 |
| Molecular Weight | 548.68 |
| Molecular Formula | C27H44N6O6 |
| Canonical SMILES | CCCCCC(CC(=O)N[O-])C(=O)N1C(CCCN1)C(=O)NC(C2=CC=[N+]3N2C(CCC3)C(=O)O)C(C)CC |