9-(3-Deoxy-3-fluoro-β-D-ribofuranosyl)-6-methyl-9H-purine
9-(3-Deoxy-3-fluoro-β-D-ribofuranosyl)-6-methyl-9H-purine is an exceptionally efficacious antiviral compound, indispensably employed in studying multifarious RNA viral infections such as influenza, hepatitis C and the pernicious human immunodeficiency virus (HIV). Executing its mechanism by impeding viral replication, it unequivocally diminishes viral burden.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1612191-88-4 |
| Pricing | Inquire |
| Cas | 1612191-88-4 |
| Molecular Weight | 268.24 |
| Molecular Formula | C11H13FN4O3 |
| Canonical SMILES | CC1=C2C(=NC=N1)N(C=N2)C3C(C(C(O3)CO)F)O |