5'(R)-C-Methylguanosine
5'(R)-C-Methylguanosine, a vital research tool in the biomedical industry, is a highly intricate biomedicine product. This modified guanosine derivative holds immense significance in RNA metabolism. Its utilization primarily centers around the exploration of RNA modification's profound influence on gene expression. Moreover, this compound provides invaluable insights into the involvement of modified nucleosides in various afflictions like cancer and neurological disorders. Empowering scientific investigations, it serves as an indispensable asset for discerning the intricacies of disease pathogenesis and therapeutic interventions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 85421-89-2 |
| Pricing | Inquire |
| Cas | 85421-89-2 |
| Molecular Weight | 297.27 |
| Molecular Formula | C11H15N5O5 |
| Canonical SMILES | CC(C1C(C(C(O1)N2C=NC3=C2N=C(NC3=O)N)O)O)O |