3'-Azido-2',3'-dideoxy-5-bromouridine
3'-Azido-2',3'-dideoxy-5-bromouridine is a highly intricate biomedical compound, emerging as a pivotal entity in the realm of drug related RNA viral infections design and development. With its prominent role as a nucleoside analogue, it gracefully orchestrates the research and development of cutting-edge antiviral medications.
| Supplier | BOC Sciences |
|---|---|
| Product # | 105784-82-5 |
| Pricing | Inquire |
| Cas | 105784-82-5 |
| Molecular Weight | 332.11 |
| Molecular Formula | C9H10BrN5O4 |
| Canonical SMILES | C1C(C(OC1N2C=C(C(=O)NC2=O)Br)CO)N=[N+]=[N-] |