a-D-Xylopyranosyl azide
a-D-Xylopyranosyl azide is a crucial compound in the research and development of various drugs targeting glycogen metabolism disorders and bacterial infections. With its azide group, a-D-Xylopyranosyl azide plays a vital role in drug discovery and development to combat diseases such as diabetes, cancer and compound-resistant infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 100842-21-5 |
| Pricing | Inquire |
| Cas | 100842-21-5 |
| Molecular Weight | 175.14 |
| Molecular Formula | C5H9N3O4 |
| Canonical SMILES | C1C(C(C(C(O1)N=[N+]=[N-])O)O)O |