5-Methyl-2-phenyloxazole-4-carboxylic Acid Methyl Ester
5-Methyl-2-phenyloxazole-4-carboxylic Acid Methyl Ester is an intermediate used to prepare 2-Phenyl-5-methyloxazole-4-carboxylic Acid (P336070) which is a building block used to prepare oxazole transthyretin amyloidogenesis inhibitors. 2-Phenyl-5-methyloxazole-4-carboxylic Acid is also used to synthesize inhibitors of HldE kinase as Gram-negative antivirulence drugs.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB060173 |
| Pricing | Inquire |
| Cas | 100063-41-0 |
| Molecular Weight | 217.22 |
| Molecular Formula | C12H11NO3 |
| Canonical SMILES | CC1=C(N=C(O1)C2=CC=CC=C2)C(=O)OC |