6-Gingerdione
6-Gingerdione is a powerful compound derived from ginger, possessing remarkable anti-inflammatory and anticancer attributes. Renowned for its exceptional bioactivity, this molecule exhibits significant efficacy in studying a diverse range of ailments, encompassing cancer , arthritis and neurodegenerative afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 61871-71-4 |
| Pricing | Inquire |
| Cas | 61871-71-4 |
| Molecular Weight | 292.30 |
| Molecular Formula | C17H24O4 |
| Canonical SMILES | CCCCCC(=O)CC(=O)CCC1=CC(=C(C=C1)O)OC |