(Z)-3-Hexenyl-3-boronic acid catechol ester
(Z)-3-Hexenyl-3-boronic acid catechol ester is a pharmaceutical intermediate used in the development and synthesis of various drugs. It facilitates the development of boron-containing organic compounds relevant to certain therapeutic applications.
| Supplier | BOC Sciences |
|---|---|
| Product # | 37490-28-1 |
| Pricing | Inquire |
| Cas | 37490-28-1 |
| Molecular Weight | 202.06 |
| Molecular Formula | C12H15BO2 |
| Canonical SMILES | B1(OC2=CC=CC=C2O1)C(=CCC)CC |