2-Acetamido-6-O-(a-2-N-acetylneuraminyl)-2-deoxy-a-D-galactopyranosyl serine
2-Acetamido-6-O-(a-2-N-acetylneuraminyl)-2-deoxy-a-D-galactopyranosyl serine, a chemical compound with profound biomedical implications, emerges as an efficacious glycosylation inhibitor within the realms of rigorous scientific investigation. With its noteworthy potential to unravel the intricate disease pathogenesis, facilitate the creation of innovative therapeutics targeting glycosylation-related disorders, and elucidate the underlying molecular mechanisms, this product assumes great significance in advancing the realm of drug efficacy assessment.
| Supplier | BOC Sciences |
|---|---|
| Product # | 114661-01-7 |
| Pricing | Inquire |
| Cas | 114661-01-7 |
| Molecular Weight | 599.54 |
| Molecular Formula | C22H37N3O16 |
| Canonical SMILES | CC(=O)NC1C(CC(OC1C(C(CO)O)O)(C(=O)O)OCC2C(C(C(C(O2)OCC(C(=O)O)N)NC(=O)C)O)O)O |