GS-CA-1
GS-CA-1 is a novel HIV capsid inhibitor developed by Gilead, which is a promisingly long-acting antiretroviral (ARV) agent. The preclinical study showed that GS-CA-1 could inhibit HIV-1 replication in human peripheral blood mononuclear cells (PBMCs) (EC50 = 140 pM).
| Supplier | BOC Sciences |
|---|---|
| Product # | 2189684-45-3 |
| Pricing | Inquire |
| Cas | 2189684-45-3 |
| Molecular Weight | 958.34 |
| Molecular Formula | C41H36ClF8N7O5S2 |
| Canonical SMILES | CC(C)(C#CC1=NC(=C(C=C1)C2=C3C(=C(C=C2)Cl)C(=NN3CC(F)F)NS(=O)(=O)C4CC4)C(CC5=CC(=CC(=C5)F)F)NC(=O)CN6C7=C(C8CC8C7(F)F)C(=N6)C(F)F)S(=O)(=O)C |