Cyclothialidine C
It is produced by the strain of Streptomyces sp. NR 0659. It and its homologues inhibit escherichia coli DNA helicases with IC50 of 0.7 μmol/L, and the reference neomycin was 1.2 μmol/L.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01120 |
| Pricing | Inquire |
| Cas | 161161-54-2 |
| Molecular Weight | 625.66 |
| Molecular Formula | C26H35N5O11S |
| Canonical SMILES | CC1=C2C(=C(C=C1O)O)CSCC(NC(=O)C(COC2=O)NC(=O)C3C(CCN3C(=O)C(C)N)O)C(=O)NC(C)C(=O)O |