Etoposide D-glucuronide
Etoposide D-glucuronide, a vital pharmaceutical compound extensively employed in the biomedical sector, acts as a pivotal metabolite of Etoposide, a potent anticancer medication. Through the process of glucuronidation within the liver, Etoposide D-glucuronide undertakes a crucial function in the eradication of harmful toxins from the system. Its predominant utilization lies within the treatment of specific forms of malignancies, notably lung cancer and testicular cancer. This scientifically profound product embodies the potential for significant advancements and breakthroughs in cancer therapy.
| Supplier | BOC Sciences |
|---|---|
| Product # | 100007-55-4 |
| Pricing | Inquire |
| Cas | 100007-55-4 |
| Molecular Weight | 762.73 |
| Molecular Formula | C36H42O18 |
| Canonical SMILES | CC1OCC2C(O1)C(C(C(O2)OC3C4COC(=O)C4C(C5=CC6=C(C=C35)OCO6)C7=CC(=C(C(=C7)OC)OC8C(C(C(C(O8)C(=O)O)O)O)O)OC)O)O |