D-Glucose-(toluene-4-sulfonylhydrazone)
D-Glucose-(toluene-4-sulfonylhydrazone) is a chemical compound revered in scientific research for its pivotal role in assessing and measuring glucose concentrations within various biological specimens. This versatile compound serves as a crucial tool in the meticulous investigation of diabetes and metabolic irregularities, offering profound insights into these intricate physiological phenomena.
| Supplier | BOC Sciences |
|---|---|
| Product # | 5328-51-8 |
| Pricing | Inquire |
| Cas | 5328-51-8 |
| Molecular Weight | 220.27 |
| Molecular Formula | C12H16N2O2 |
| Canonical SMILES | CCCC(=O)NNC(=O)C1=CC=CC=C1C |