5'-O-DMT-cytidine
5'-O-DMT-cytidine is a highly influential and extensively utilized component, having extraordinary aptitude as a remarkable countermeasure against both DNA and RNA viral compounds. Profoundly indispensable in the confrontment of pernicious viral afflictions, such as herpes simplex, HIV and hepatitis, this exalted compound exhibits an unparalleled capability in suppressing viral replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 112897-99-1 |
| Pricing | Inquire |
| Cas | 112897-99-1 |
| Molecular Weight | 545.58 |
| Molecular Formula | C30H31N3O7 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4C(C(C(O4)N5C=CC(=NC5=O)N)O)O |