Glycoursodeoxycholic acid-[2,2,4,4-d4]
Glycoursodeoxycholic acid-[2,2,4,4-d4] is the labelled analogue of Glycoursodeoxycholic Acid. Glycoursodeoxycholic Acid is a bile acid-glycine conjugate produced in the metabolism of ursodeoxycholic acid. It can be used as an anticholelithogenic.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-001662 |
| Pricing | Inquire |
| Cas | 2044276-17-5 |
| Molecular Weight | 453.65 |
| Molecular Formula | C26H39D4NO5 |
| Canonical SMILES | CC(CCC(=O)NCC(=O)O)C1CCC2C1(CCC3C2C(CC4C3(CCC(C4)O)C)O)C |