A 357300 hydrochloride
A 357300 hydrochloride is a potent and reversible inhibitor of methionine aminopeptidase-2 (MetAP-2). In murine models, it significantly inhibits CHP-134-derived neuroblastoma s.c. xenograft growth rate with a treatment-to-control (T/C) ratio at day 24 of 0.19 (P < 0.001) without toxicity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 369358-07-6 |
| Pricing | Inquire |
| Cas | 369358-07-6 |
| Molecular Weight | 396.33 |
| Molecular Formula | C15H22ClN3O3S.HCl |
| Canonical SMILES | CC(C)SCCC(C(C(=O)NNC(=O)C1=CC(=CC=C1)Cl)O)N |