3',5'-O-(1,1,3,3-Tetraisopropyl-1,3-disiloxanediyl)guanosine
3',5'-O-(1,1,3,3-Tetraisopropyl-1,3-disiloxanediyl)guanosine is a vital compound used in the biomedical industry. It acts as a crucial building block in the synthesis of RNA and DNA molecules, playing a significant role in gene expression and regulation. This compound finds utility in research related to nucleic acids, drug discovery, and the development of treatments targeting diseases such as cancer and viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 69304-44-5 |
| Pricing | Inquire |
| Cas | 69304-44-5 |
| Molecular Weight | 525.76 |
| Molecular Formula | C22H39N5O6Si2 |
| Canonical SMILES | CC(C)[Si]1(OCC2C(C(C(O2)N3C=NC4=C3N=C(NC4=O)N)O)O[Si](O1)(C(C)C)C(C)C)C(C)C |