5'-O-(Dimethoxytrityl)-5-[N-(6-(trifluoroacetamido)hexyl)-3-(E)-acrylamido]-2'-deoxyuridine
The 5'-O-(Dimethoxytrityl)-5-[N-(6-(trifluoroacetamido)hexyl)-3-(E)-acrylamido]-2'-deoxyuridine represents a pivotal compound utilized in the field of biomedicine due to its indispensable role in the synthesis and advancement of potential antiviral agents. By specifically targeting viral replication processes and crucial enzymes, this product exhibits considerable promise in the treatment of a diverse range of viral infections. Thus, it assumes a vital role in the progression of pharmaceutical research, offering prospective solutions for tackling various viral diseases with utmost efficacy.
| Supplier | BOC Sciences |
|---|---|
| Product # | 252337-59-0 |
| Pricing | Inquire |
| Cas | 252337-59-0 |
| Molecular Weight | 794.84 |
| Molecular Formula | C41H45F3N4O9 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4C(CC(O4)N5C=C(C(=O)NC5=O)C=CC(=O)NCCCCCCNC(=O)C(F)(F)F)O |