Dynamin inhibitory peptide
| Supplier | Creative Peptides |
|---|---|
| Product # | R0850 |
| CAS # | 251634-21-6 |
| Pricing | Inquire |
| LabelingTarget | GTPase dynamin |
| MolecularFormula | C47H80N18O14 |
| MolecularWeight | 1121.26 |
| Sequence | QVPSRPNRAP |
| Storage | -20°C |
| Explanation | Dynamin Inhibitory Peptide is a peptide inhibitor of the GTPase dynamin, which competitively blocks binding of dynamin to amphiphysin, thus it prevents endocytosis when administered intracellularly. It lead to GABAA receptor internalization reduce and miniature ISPC amplitude and frequency in neurons expressing GABAA receptors increase. |
| Activity | Inhibitor |
| InChI | InChI=1S/C47H80N18O14/c1-23(2)35(62-36(69)25(48)14-15-33(49)67)44(77)64-19-7-12-31(64)41(74)61-29(22-66)39(72)59-27(10-5-17-56-47(53)54)43(76)63-18-6-11-30(63)40(73)60-28(21-34(50)68)38(71)58-26(9-4-16-55-46(51)52)37(70)57-24(3)42(75)65-20-8-13-32(65)45(78)79/h23-32,35,66H,4-22,48H2,1-3H3,(H2,49,67)(H2,50,68)(H,57,70)(H,58,71)(H,59,72)(H,60,73)(H,61,74)(H,62,69)(H,78,79)(H4,51,52,55)(H4,53,54,56)/t24-,25-,26-,27-,28-,29-,30-,31-,32-,35-/m0/s1 |
| InChIKey | LHQOQXYEPUSHJL-LNIRUYPRSA-N |
| Solubility | Soluble in DMSO |
| IsomericSMILES | C[C@@H](C(=O)N1CCC[C@H]1C(=O)O)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(=O)N)NC(=O)[C@@H]2CCCN2C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CO)NC(=O)[C@@H]3CCCN3C(=O)[C@H](C(C)C)NC(=O)[C@H](CCC(=O)N)N |
| Purity | >98 % |
| LongTermStorageConditions | -20 °C |