Racemomycin A
It is produced by the strain of Str. racemochromogenes 229. It has broad spectrum antibacterial activity and antifungal effect, and it can inhibit PR-8 of influenza virus in tissue culture.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02168 |
| Pricing | Inquire |
| Cas | 3808-42-2 |
| Molecular Weight | 502.52 |
| Molecular Formula | C19H34N8O8 |
| Canonical SMILES | C1C(C2C(C(=O)N1)N=C(N2)NC3C(C(C(C(O3)CO)OC(=O)N)O)NC(=O)CC(CCCN)N)O |