Guanfu base H
Guanfu base H is a diterpenoid alkaloid isolated from Aconitum coreanum. It has antiplasmodial activity against the malarial Plasmodium falciparum strains TM4/8.2 (wild type) and K1CB1 (IC50s: 4 μM and 3.6 μM).
| Supplier | BOC Sciences |
|---|---|
| Product # | 4758-99-0 |
| Pricing | Inquire |
| Cas | 4758-99-0 |
| Molecular Weight | 379.96 |
| Molecular Formula | C22H34ClNO2 |
| Canonical SMILES | CC12CCCC3(C1CCC45C3CC(CC4)C(=C)C5O)C=[N+](C2)CCO |