2-Aminophenyl b-D-glucuronide HCl
2-Aminophenyl b-D-glucuronide HCl, a pharmaceutical compound within the biomedicine sector for investigational aims, has applicability predominantly lies in drug metabolism research and the identification of drug metabolites. This particular product assumes a pivotal role in comprehending the intricate nuances of pharmacokinetics and transportation mechanisms, specifically pertaining to glucuronidation reactions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 15959-03-2 |
| Pricing | Inquire |
| Cas | 15959-03-2 |
| Molecular Weight | 321.71 |
| Molecular Formula | C12H15NO7.HCl |
| Canonical SMILES | C1=CC=C(C(=C1)N)OC2C(C(C(C(O2)C(=O)O)O)O)O |