21-Dehydro-17-Deoxy-Dexamethasone
21-Dehydro-17-Deoxy-Dexamethasone is a highly potent synthetic corticosteroid widely utilized in the biomedical industry exhibiting remarkable anti-inflammatory and immunosuppressive attributes. Its efficacious pharmacological profile renders it invaluable in studying diverse inflammatory ailments like allergic reactions, skin maladies and rheumatoid arthritis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1188271-71-7 |
| Pricing | Inquire |
| Cas | 1188271-71-7 |
| Molecular Weight | 374.45 |
| Molecular Formula | C22H27FO4 |
| Canonical SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1C(=O)C=O)C)O)F)C |