9-(2'-Deoxy-2'-fluoro-b-D-ribofuranosyl)-2-fluoroadenine
9-(2'-Deoxy-2'-fluoro-b-D-ribofuranosyl)-2-fluoroadenine, an extraordinary antiviral compound, exhibits immense potential in the biomedical field for combating viral infections induced by DNA viruses. Its exceptional efficacy stems from its ability to disrupt viral DNA synthesis, thereby impeding viral replication. This nucleoside analogue has demonstrated remarkable effectiveness against a multitude of viruses, including herpes simplex virus type 1 (HSV-1) and 2 (HSV-2), varicella-zoster virus (VZV), and Epstein-Barr virus (EBV).
| Supplier | BOC Sciences |
|---|---|
| Product # | 147048-53-1 |
| Pricing | Inquire |
| Cas | 147048-53-1 |
| Molecular Weight | 287.23 |
| Molecular Formula | C10H11F2N5O3 |
| Canonical SMILES | C1=NC2=C(N=C(N=C2N1C3C(C(C(O3)CO)O)F)F)N |