1,4-D-Xylobiose
1,4-D-Xylobiose is a vital substance used in the biomedical industry. It exhibits potential applications as a dietary supplement due to its prebiotic properties. It can serve as a nutrition source for beneficial gut bacteria, promoting a healthy intestinal environment.
| Supplier | BOC Sciences |
|---|---|
| Product # | 6860-47-5 |
| Pricing | Inquire |
| Cas | 6860-47-5 |
| Molecular Weight | 282.25 |
| Molecular Formula | C10H18O9 |
| Canonical SMILES | C1C(C(C(C(O1)OC2COC(C(C2O)O)O)O)O)O |