2',3'-Dideoxyadenosine 5'-Triphosphate
ddATP is an inhibitor of reverse transcriptases from retroviruses, such as HIV-1 and visna (Kis = 20 and 37 nM, respectively). ddATP is commonly used to terminate chain extension produced by the Taq polymerase for its competitive effect with dATP in cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 24027-80-3 |
| Pricing | Inquire |
| Cas | 24027-80-3 |
| Molecular Weight | 475.18 |
| Molecular Formula | C10H16N5O11P3 |
| Canonical SMILES | C1CC(OC1COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N2C=NC3=C2N=CN=C3N |