D-Galactose diethyldithioacetal
D-Galactose diethyldithioacetal, an essential compound extensively utilized in the field of biomedicine, exhibits immense potential for addressing disorders linked to galactose metabolism, notably galactosemia. Serving as a contributor of D-galactose, this compound exerts advantageous impacts on diverse physiological mechanisms.
| Supplier | BOC Sciences |
|---|---|
| Product # | 5463-33-2 |
| Pricing | Inquire |
| Cas | 5463-33-2 |
| Molecular Weight | 286.41 |
| Molecular Formula | C10H22O5S2 |
| Canonical SMILES | CCSC(C(C(C(C(CO)O)O)O)O)SCC |