3-Phenoxy-8-azabicyclo[3.2.1]octane hydrochloride
3-Phenoxy-8-azabicyclo[3.2.1]octane hydrochloride is a potent and selective dopamine D2 receptor agonist and has been widely used to study the mechanism of dopamine signaling and its role in various physiological and pathological processes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1955540-15-4 |
| Pricing | Inquire |
| Cas | 1955540-15-4 |
| Molecular Weight | 239.74 |
| Molecular Formula | C13H18ClNO |
| Canonical SMILES | C1CC2CC(CC1N2)OC3=CC=CC=C3.Cl |