3'-N-Acetyl-3'-amino-3'-deoxyuridine
3'-N-Acetyl-3'-amino-3'-deoxyuridine is a powerful antiviral agent, extensively employed for the research of diverse viral infections including herpes and HIV/AIDS. By skillfully targeting and suppressing viral enzymes, this compound effectively hampers viral DNA research and development, thwarting the nefarious replication of the virus.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2305415-89-6 |
| Pricing | Inquire |
| Cas | 2305415-89-6 |
| Molecular Weight | 285.25 |
| Molecular Formula | C11H15N3O6 |
| Canonical SMILES | CC(=O)NC1C(OC(C1O)N2C=CC(=O)NC2=O)CO |