3-Fluoro-4-methoxyphenylboronic Acid
Reactant for: Preparation of hydroxyphenylnaphthols as 17ß-hydroxysteroid dehydrogenase Type 2 inhibitors; Regioselective Suzuki coupling; Ruthenium-catalyzed arylation reactions; Synthesis of amino-trimethoxyphenyl-aryl thiazoles as microtubule inhibitors and potential antitumors; Rhodium catalyzed cyanation; Petasis reaction.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB010416 |
| Pricing | Inquire |
| Cas | 149507-26-6 |
| Molecular Weight | 169.95 |
| Molecular Formula | C7H8FO3B |
| Canonical SMILES | B(C1=CC(=C(C=C1)OC)F)(O)O |