5'-Azido-2',5'-dideoxyadenosine
5'-Azido-2',5'-dideoxyadenosine, a pivotal compound employed in biomedical research due to its distinctive characteristics, exhibits remarkable antiviral properties. By suppressing the reverse transcriptase enzyme, it efficaciously impedes viral DNA synthesis, rendering it an efficacious antiviral drug for combatting diverse viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 42204-43-3 |
| Pricing | Inquire |
| Cas | 42204-43-3 |
| Molecular Weight | 276.26 |
| Molecular Formula | C10H12N8O2 |
| Canonical SMILES | C1C(C(OC1N2C=NC3=C(N=CN=C32)N)CN=[N+]=[N-])O |