1-[(2'-Cyano-1,1'-biphenyl-4-yl)methyl]-2-ethoxy-7-benzimidazolecarboxylic Acid Methyl Ester-[d5]
1-[(2'-Cyano-1,1'-biphenyl-4-yl)methyl]-2-ethoxy-7-benzimidazolecarboxylic Acid Methyl Ester-[d5] is the labelled analogue of 1-[(2'-Cyano-1,1'-biphenyl-4-yl)methyl]-2-ethoxy-7-benzimidazolecarboxylic Acid Methyl Ester, which is an intermediate in the synthesis of Azilsartan. Azilsartan is an angiotensin II receptor antagonist.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-006390 |
| Pricing | Inquire |
| Cas | 1794783-33-7 |
| Molecular Weight | 416.48 |
| Molecular Formula | C25H16D5N3O3 |
| Canonical SMILES | CCOC1=NC2=CC=CC(=C2N1CC3=CC=C(C=C3)C4=CC=CC=C4C#N)C(=O)OC |