5-Bromo-4-chloro-3-indolyl b-L-fucopyranoside
5-Bromo-4-chloro-3-indolyl β-L-fucopyranoside, renowned for its indispensability, exerts significant influence within the biomedical realm. Acting as a chromogenic substrate unraveling the activity of β-galactosidase, it propels the examination of gene expression to new heights.
| Supplier | BOC Sciences |
|---|---|
| Product # | 125328-84-9 |
| Pricing | Inquire |
| Cas | 125328-84-9 |
| Molecular Weight | 392.63 |
| Molecular Formula | C14H15BrClNO5 |
| Canonical SMILES | CC1C(C(C(C(O1)OC2=CNC3=C2C(=C(C=C3)Br)Cl)O)O)O |