Bromoacetamido-PEG2-acid
Bromoacetamido-PEG2-acid is a PEG linker containing a bromide group and a terminal carboxylic acid. The bromide (Br) is a very good leaving group for nucleophilic substitution reactions. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The hydrophilic PEG spacer increases solubility in aqueous media.
| Supplier | BOC Sciences |
|---|---|
| Product # | BP-500346 |
| Pricing | Inquire |
| Cas | 1415800-44-0 |
| Molecular Weight | 298.13 |
| Molecular Formula | C9H16BrNO5 |
| Canonical SMILES | C(COCCOCCNC(=O)CBr)C(=O)O |