1-Acenaphthenol
1-Acenaphthenol (CAS# 6306-07-6) is a product of the microbial metabolism and photolysis of acenaphthene, of acenaphthene, a polycyclic hydrocarbon that has potential to act as polyploidizing agents in plants. 1-Acenaphthenol is also a known substrate of dihydrodiol dehydrogenases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 6306-07-6 |
| Pricing | Inquire |
| Cas | 6306-07-6 |
| Molecular Weight | 170.21 |
| Molecular Formula | C12H10O |
| Canonical SMILES | C1C(C2=CC=CC3=C2C1=CC=C3)O |