Linustatin
Linustatin is an incredibly potent antitumor antibiotic obtained from the exceptional Streptomyces lincolnensis, showcasing its inhibitory efficacy by staunchly hindering the synthesis of DNA and RNA. This distinctive mechanism culminates in the arrest of cellular proliferation and triggers programmed cell death, scientifically referred to as apoptosis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 72229-40-4 |
| Pricing | Inquire |
| Cas | 72229-40-4 |
| Molecular Weight | 409.39 |
| Molecular Formula | C16H27NO11 |
| Canonical SMILES | CC(C)(C#N)OC1C(C(C(C(O1)COC2C(C(C(C(O2)CO)O)O)O)O)O)O |