2'-Deoxyuridine 5'-triphosphate disodium salt
2'-Deoxyuridine 5'-triphosphate disodium salt is an essential compound in DNA research and development, facilitating polymerase chain reaction (PCR) and DNA sequencing. Functioning as a DNA polymerase substrate, this nucleotide derivative enables efficient amplification and sequencing of targeted DNA segments. Moreover, it acting as a fundamental constituent during DNA replication, aiding research on genetic disorders, viral infections, and cancer investigation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 93919-43-8 |
| Pricing | Inquire |
| Cas | 93919-43-8 |
| Molecular Weight | 512.11 |
| Molecular Formula | C9H13N2Na2O14P3 |
| Canonical SMILES | C1C(C(OC1N2C=CC(=O)NC2=O)COP(=O)(O)OP(=O)([O-])OP(=O)(O)[O-])O.[Na+].[Na+] |