Fmoc-O-Phospho-L-tyrosine
Fmoc-O-Phospho-L-tyrosine: Considered a pivotal component in the intricate process of synthesizing peptide-derived inhibitors, this compound holds promising potential in the realm of cancer and inflammatory disease therapeutics. Its multifaceted role underscores the complexity and nuanced nature of therapeutic peptide design and development.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-008163 |
| Pricing | Inquire |
| Cas | 147762-53-6 |
| Molecular Weight | 483.41 |
| Molecular Formula | C24H22NO8P |
| Canonical SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC4=CC=C(C=C4)OP(=O)(O)O)C(=O)O |