Colchicine-[d3]
Colchicine-[d3], is the labelled analogue of Colchicine. Colchicine, a toxic plant-derived alkaloid extracted from plants of the genus Colchicum, inhibits microtubule polymerization (IC50 = 3.2 μM). Colchicine can lower body temperature, inhibit the respiratory center, enhance the effect of sympathomimetic drugs, constrict blood vessels, and raise blood pressure.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002329 |
| Pricing | Inquire |
| Cas | 1217625-62-1 |
| Molecular Weight | 402.46 |
| Molecular Formula | C22H22D3NO6 |
| Canonical SMILES | CC(=O)NC1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)OC)OC)OC)OC |