5,7-Dichloro-8-hydroxyquinoline b-D-glucuronide
5,7-Dichloro-8-hydroxyquinoline b-D-glucuronide is a metabolite possessing the distinctive attribute of glucuronidation assuming a fundamental and indispensable role in unraveling the intricate processes entailing the metabolism and pharmacokinetics of the esteemed drug 5,7-Dichloro-8-hydroxyquinoline.
| Supplier | BOC Sciences |
|---|---|
| Product # | 40951-47-1 |
| Pricing | Inquire |
| Cas | 40951-47-1 |
| Molecular Weight | 390.17 |
| Molecular Formula | C15H13Cl2NO7 |
| Canonical SMILES | C1=CC2=C(C(=C(C=C2Cl)Cl)OC3C(C(C(C(O3)C(=O)O)O)O)O)N=C1 |