2,3,4,6-Tetra-O-acetyl-b-D-galactopyranosyl isothiocyanate
2,3,4,6-Tetra-O-acetyl-b-D-galactopyranosyl isothiocyanate is a biomedicine product used in the field of chemical biology. This compound acts as a reagent for the selective labeling and modification of carbohydrates containing primary amines. It finds application in the study of glycoproteins, glycolipids, and other biomolecules involved in cellular processes. This product is indispensable in research related to carbohydrate-based therapeutics and drug design.
| Supplier | BOC Sciences |
|---|---|
| Product # | 41135-18-6 |
| Pricing | Inquire |
| Cas | 41135-18-6 |
| Molecular Weight | 389.38 |
| Molecular Formula | C15H19NO9S |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)N=C=S)OC(=O)C)OC(=O)C)OC(=O)C |