5-Nitrothiophene-2-carboxylic acid
5-Nitrothiophene-2-carboxylic acid (CAS# 6317-37-9) is a reagent used in the preparation of benzothiophene amides which fuctions as nicotinamide ribosyltransferase inhibitors with potential antitumor and anticancer activities. It also functions as an intermediate in varying organic transformations.
| Supplier | BOC Sciences |
|---|---|
| Product # | 6317-37-9 |
| Pricing | Inquire |
| Cas | 6317-37-9 |
| Molecular Weight | 173.15 |
| Molecular Formula | C5H3NO4S |
| Canonical SMILES | C1=C(SC(=C1)[N+](=O)[O-])C(=O)O |