AN-12-H5
AN-12-H5, an antienterovirus compound, targets the replication processes of PV and enterovirus 71 (EV71). AN-12-H5 is a bifunctional, enviroxime-like anti-Enterovirus compound that inhibits replication and the early stage of enterovirus 71 infection with EC50 of 0.55 uM; mutations in capsid proteins (G3112A, VP1-Ala224Thr, and G2396A, VP3-Arg227Lys mutations) are resistant to AN-12-H5.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1193340-31-6 |
| Pricing | Inquire |
| Cas | 1193340-31-6 |
| Molecular Weight | 513.645 |
| Molecular Formula | C24H23N3O4S3 |
| Canonical SMILES | CSC1=CC=C(C=C1)C2=CC3=C(C=C2)NC(=O)C4CC(CCN4C3=O)NS(=O)(=O)C5=CC=CS5 |