2-O-Methylthymidine
2-O-Methylthymidine, a nucleoside analogue of formidable antiviral and anticancer qualities, proves useful as a research tool that introduces new antiviral drugs whilst furthering cancer diagnosis and treatment studies. Its versatility continues to be shown as it also exhibits promising therapeutic potential in treating hepatitis B and Epstein-Barr virus infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 37085-48-6 |
| Pricing | Inquire |
| Cas | 37085-48-6 |
| Molecular Weight | 256.26 |
| Molecular Formula | C11H16N2O5 |
| Canonical SMILES | CC1=CN(C(=NC1=O)OC)C2CC(C(O2)CO)O |