Blasticidin S Hydrochloride
Blasticidin S HCl is a nucleoside antibiotic that is first isolated from Streptomyces griseochromogenes. Blasticidin S inhibits protein synthesis in both prokaryotic and eukaryotic cells via suppressing peptide bond formation by the ribosome.
| Supplier | BOC Sciences |
|---|---|
| Product # | 3513-03-9 |
| Pricing | Inquire |
| Cas | 3513-03-9 |
| Molecular Weight | 458.90 |
| Molecular Formula | C17H26N8O5.HCl |
| Canonical SMILES | CN(CCC(CC(=O)NC1C=CC(OC1C(=O)O)N2C=CC(=NC2=O)N)N)C(=N)N.Cl |