6-(6-(6-Aminohexanamido)hexanamido)hexanoic Acid
6-(6-(6-Aminohexanamido)hexanamido)hexanoic Acid is used in the making of a preconjugate which serves as immunoreactive conjugate useful as a developer antigen in a competitive inhibition immunoassay for the polymorphic analyte. Also used in the efficient synthesis of a heterobifunctional coupling agent.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB061458 |
| Pricing | Inquire |
| Cas | 5776-78-3 |
| Molecular Weight | 357.49 |
| Molecular Formula | C18H35N3O4 |
| Canonical SMILES | C(CCC(=O)NCCCCCC(=O)NCCCCCC(=O)O)CCN |