4'-Hydroxy Dasatinib
4'-Hydroxy Dasatinib is the formidable compound renowned for its unparalleled efficacy in studying chronic myeloid leukemia (CML) and Philadelphia chromosome-positive acute lymphoblastic leukemia (Ph+ ALL)—operates through the discerning suppression of numerous malignant protein kinases. By specifically antagonizing BCR-ABL, this remarkable substance precipitates the induction of apoptosand the impediment of tumor proliferation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 910297-57-3 |
| Pricing | Inquire |
| Cas | 910297-57-3 |
| Molecular Weight | 504.01 |
| Molecular Formula | C22H26ClN7O3S |
| Canonical SMILES | CC1=CC(=CC(=C1NC(=O)C2=CN=C(S2)NC3=CC(=NC(=N3)C)N4CCN(CC4)CCO)Cl)O |