12-ketochenodeoxycholic acid
12-ketochenodeoxycholic acid, a derivative of chenodeoxycholic acid, plays a pivotal role in the intricate process of bile acid biosynthesis. This compound has garnered attention in the realm of medical research due to its promising therapeutic potential in addressing conditions linked to aberrant bile acid synthesis and hepatic illnesses.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2458-08-4 |
| Pricing | Inquire |
| Cas | 2458-08-4 |
| Molecular Weight | 406.56 |
| Molecular Formula | C24H38O5 |
| Canonical SMILES | CC(CCC(=O)O)C1CCC2C1(C(=O)CC3C2C(CC4C3(CCC(C4)O)C)O)C |