N-(Dithiocarboxy)-N-methyl-D-glucamine sodium salt
N-(Dithiocarboxy)-N-methyl-D-glucamine sodium salt is a compound used in biomedical research as a chelating agent for metal ions. It can also be used to stabilize certain enzymes and proteins. In pharmacology, it has been studied for its potential use in treating neurodegenerative diseases due to its ability to scavenge free radicals and reduce oxidative stress.
| Supplier | BOC Sciences |
|---|---|
| Product # | 91840-27-6 |
| Pricing | Inquire |
| Cas | 91840-27-6 |
| Molecular Weight | 293.34 |
| Molecular Formula | C8H16NNaO5S2 |
| Canonical SMILES | CN(CC(C(C(C(CO)O)O)O)O)C(=S)[S-].[Na+] |