Bezafibrate-[d4]
Bezafibrate-[d4] is the labelled analogue of Bezafibrate. Bezafibrate is a fibrate drug used for the treatment of hyperlipidaemia. It helps to lower LDL cholesterol and triglyceride in the blood, and increase HDL.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-011810 |
| Pricing | Inquire |
| Cas | 1189452-53-6 |
| Molecular Weight | 365.85 |
| Molecular Formula | C19H16D4ClNO4 |
| Canonical SMILES | CC(C)(C(=O)O)OC1=CC=C(C=C1)CCNC(=O)C2=CC=C(C=C2)Cl |